C25H38N2O5 — CID 71596265
N'-phenyl-N-[2-[[(5R,9R,10S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethyl]ethane-1,2-diamine (PubChem CID 71596265) has the molecular formula C25H38N2O5 and a molecular weight of 446.59 g/mol. Its IUPAC name is N'-phenyl-N-[2-[[(5R,9R,10S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethyl]ethane-1,2-diamine.
| Compound Name | N'-phenyl-N-[2-[[(5R,9R,10S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 71596265 |
| Molecular Formula | C25H38N2O5 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | N'-phenyl-N-[2-[[(5R,9R,10S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethyl]ethane-1,2-diamine |
| SMILES | C[C@@H]1CCC2[C@@H](C)[C@@H](OCCNCCNc3ccccc3)OC3OC4(C)CCC1[C@]32OO4 |
| InChI | InChI=1S/C25H38N2O5/c1-17-9-10-21-18(2)22(28-16-15-26-13-14-27-19-7-5-4-6-8-19)29-23-25(21)20(17)11-12-24(3,30-23)31-32-25/h4-8,17-18,20-23,26-27H,9-16H2,1-3H3/t17-,18-,20?,21?,22+,23?,24?,25-/m1/s1 |
| InChIKey | FEDPJXUIBBYSKQ-WXRVUACGSA-N |
| XLogP | 3.91 |
| TPSA | 70.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|