C18H15F3NO4S2+ — CID 71597724
3-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonic acid (PubChem CID 71597724) has the molecular formula C18H15F3NO4S2+ and a molecular weight of 430.45 g/mol. Its IUPAC name is 3-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonic acid.
| Compound Name | 3-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 71597724 |
| Molecular Formula | C18H15F3NO4S2+ |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | 3-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonic acid |
| SMILES | COc1ccc2cc3sc4ccccc4c3[n+](C)c2c1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C17H14NOS.CHF3O3S/c1-18-14-10-12(19-2)8-7-11(14)9-16-17(18)13-5-3-4-6-15(13)20-16;2-1(3,4)8(5,6)7/h3-10H,1-2H3;(H,5,6,7)/q+1; |
| InChIKey | NAQYZQBIJBHXMJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|