About ethyl 4-phenyl-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate
ethyl 4-phenyl-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate (PubChem CID 71599593) has the molecular formula C15H13N3O2
and a molecular weight of 267.29 g/mol. Its IUPAC name is ethyl 4-phenyl-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-phenyl-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate |
| PubChem CID | 71599593 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | ethyl 4-phenyl-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c[nH]c2ncnc(-c3ccccc3)c12 |
| InChI | InChI=1S/C15H13N3O2/c1-2-20-15(19)11-8-16-14-12(11)13(17-9-18-14)10-6-4-3-5-7-10/h3-9H,2H2,1H3,(H,16,17,18) |
| InChIKey | LIODERMWZLOSSA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-phenyl-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-phenyl-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate?
The IUPAC name of ethyl 4-phenyl-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate (CID 71599593) is ethyl 4-phenyl-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate.
What is the SMILES notation for ethyl 4-phenyl-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate?
The canonical SMILES for ethyl 4-phenyl-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate is CCOC(=O)c1c[nH]c2ncnc(-c3ccccc3)c12.
What is the InChIKey of ethyl 4-phenyl-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate?
The InChIKey is LIODERMWZLOSSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3O2/c1-2-20-15(19)11-8-16-14-12(11)13(17-9-18-14)10-6-4-3-5-7-10/h3-9H,2H2,1H3,(H,16,17,18).
What are the key properties of ethyl 4-phenyl-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate?
ethyl 4-phenyl-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate has a molecular weight of 267.29 g/mol, XLogP of 2.80, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-phenyl-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate is sourced from PubChem (CID 71599593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).