C15H21N4O3+ — CID 7159990
N-(4-methoxyphenyl)-N'-[(1-methylpiperidin-1-ium-4-ylidene)amino]oxamide (PubChem CID 7159990) has the molecular formula C15H21N4O3+ and a molecular weight of 305.36 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-N'-[(1-methylpiperidin-1-ium-4-ylidene)amino]oxamide.
| Compound Name | N-(4-methoxyphenyl)-N'-[(1-methylpiperidin-1-ium-4-ylidene)amino]oxamide |
|---|---|
| PubChem CID | 7159990 |
| Molecular Formula | C15H21N4O3+ |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | N-(4-methoxyphenyl)-N'-[(1-methylpiperidin-1-ium-4-ylidene)amino]oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)NN=C2CC[NH+](C)CC2)cc1 |
| InChI | InChI=1S/C15H20N4O3/c1-19-9-7-12(8-10-19)17-18-15(21)14(20)16-11-3-5-13(22-2)6-4-11/h3-6H,7-10H2,1-2H3,(H,16,20)(H,18,21)/p+1 |
| InChIKey | WNWRXDYJRSCOKA-UHFFFAOYSA-O |
| XLogP | -0.59 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|