C14H18BrN4O2+ — CID 7105949
N-(4-bromophenyl)-N'-[(1-methylpiperidin-1-ium-4-ylidene)amino]oxamide (PubChem CID 7105949) has the molecular formula C14H18BrN4O2+ and a molecular weight of 354.23 g/mol. Its IUPAC name is N-(4-bromophenyl)-N'-[(1-methylpiperidin-1-ium-4-ylidene)amino]oxamide.
| Compound Name | N-(4-bromophenyl)-N'-[(1-methylpiperidin-1-ium-4-ylidene)amino]oxamide |
|---|---|
| PubChem CID | 7105949 |
| Molecular Formula | C14H18BrN4O2+ |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | N-(4-bromophenyl)-N'-[(1-methylpiperidin-1-ium-4-ylidene)amino]oxamide |
| SMILES | C[NH+]1CCC(=NNC(=O)C(=O)Nc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C14H17BrN4O2/c1-19-8-6-12(7-9-19)17-18-14(21)13(20)16-11-4-2-10(15)3-5-11/h2-5H,6-9H2,1H3,(H,16,20)(H,18,21)/p+1 |
| InChIKey | LHZKHSUQVLEUMX-UHFFFAOYSA-O |
| XLogP | 0.17 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|