C20H19NO2 — CID 7160001
(4R)-5-acetyl-1-benzyl-4-phenyl-3,4-dihydropyridin-2-one (PubChem CID 7160001) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is (4R)-5-acetyl-1-benzyl-4-phenyl-3,4-dihydropyridin-2-one.
| Compound Name | (4R)-5-acetyl-1-benzyl-4-phenyl-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 7160001 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (4R)-5-acetyl-1-benzyl-4-phenyl-3,4-dihydropyridin-2-one |
| SMILES | CC(=O)C1=CN(Cc2ccccc2)C(=O)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H19NO2/c1-15(22)19-14-21(13-16-8-4-2-5-9-16)20(23)12-18(19)17-10-6-3-7-11-17/h2-11,14,18H,12-13H2,1H3/t18-/m1/s1 |
| InChIKey | BRXXDFBJQKCILZ-GOSISDBHSA-N |
| XLogP | 3.68 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |