C19H32O4 — CID 71600322
ethyl (3R,4E,6E)-3-acetyloxy-4-methyltetradeca-4,6-dienoate (PubChem CID 71600322) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is ethyl (3R,4E,6E)-3-acetyloxy-4-methyltetradeca-4,6-dienoate.
| Compound Name | ethyl (3R,4E,6E)-3-acetyloxy-4-methyltetradeca-4,6-dienoate |
|---|---|
| PubChem CID | 71600322 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | ethyl (3R,4E,6E)-3-acetyloxy-4-methyltetradeca-4,6-dienoate |
| SMILES | CCCCCCC/C=C/C=C(\C)[C@@H](CC(=O)OCC)OC(C)=O |
| InChI | InChI=1S/C19H32O4/c1-5-7-8-9-10-11-12-13-14-16(3)18(23-17(4)20)15-19(21)22-6-2/h12-14,18H,5-11,15H2,1-4H3/b13-12+,16-14+/t18-/m1/s1 |
| InChIKey | PDFTYHAULNRFRO-HXEOLFSZSA-N |
| XLogP | 4.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|