C23H38N2O4 — CID 71601509
CID 71601509 (PubChem CID 71601509) has the molecular formula C23H38N2O4 and a molecular weight of 406.57 g/mol.
| Compound Name | CID 71601509 |
|---|---|
| PubChem CID | 71601509 |
| Molecular Formula | C23H38N2O4 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.28 |
| IUPAC Name | — |
| SMILES | CC(C)(N)CNC(=O)CC1CCC2(CC1)COC1(OO2)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C23H38N2O4/c1-21(2,24)13-25-20(26)12-15-3-5-22(6-4-15)14-27-23(29-28-22)18-8-16-7-17(10-18)11-19(23)9-16/h15-19H,3-14,24H2,1-2H3,(H,25,26) |
| InChIKey | LLBMFUWNUXRCKZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|