C25H17NO4 — CID 7160228
(4aS,9aR)-6-[1-(2-oxochromen-3-yl)ethylideneamino]-4a,9a-dihydroanthracene-9,10-dione (PubChem CID 7160228) has the molecular formula C25H17NO4 and a molecular weight of 395.41 g/mol. Its IUPAC name is (4aS,9aR)-6-[1-(2-oxochromen-3-yl)ethylideneamino]-4a,9a-dihydroanthracene-9,10-dione.
| Compound Name | (4aS,9aR)-6-[1-(2-oxochromen-3-yl)ethylideneamino]-4a,9a-dihydroanthracene-9,10-dione |
|---|---|
| PubChem CID | 7160228 |
| Molecular Formula | C25H17NO4 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | (4aS,9aR)-6-[1-(2-oxochromen-3-yl)ethylideneamino]-4a,9a-dihydroanthracene-9,10-dione |
| SMILES | C/C(=N\c1ccc2c(c1)C(=O)[C@H]1C=CC=C[C@H]1C2=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C25H17NO4/c1-14(20-12-15-6-2-5-9-22(15)30-25(20)29)26-16-10-11-19-21(13-16)24(28)18-8-4-3-7-17(18)23(19)27/h2-13,17-18H,1H3/b26-14+/t17-,18+/m1/s1 |
| InChIKey | QNXZAMGUPFACBX-UTMDGHJCSA-N |
| XLogP | 4.67 |
| TPSA | 76.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|