C39H71NO6 — CID 71603722
[19-(cyclohexanecarbonyloxy)-10-[4-(dimethylamino)butanoyloxy]nonadecyl] cyclohexanecarboxylate (PubChem CID 71603722) has the molecular formula C39H71NO6 and a molecular weight of 650.00 g/mol. Its IUPAC name is [19-(cyclohexanecarbonyloxy)-10-[4-(dimethylamino)butanoyloxy]nonadecyl] cyclohexanecarboxylate.
| Compound Name | [19-(cyclohexanecarbonyloxy)-10-[4-(dimethylamino)butanoyloxy]nonadecyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 71603722 |
| Molecular Formula | C39H71NO6 |
| Molecular Weight | 650.00 g/mol |
| Exact Mass | 649.53 |
| IUPAC Name | [19-(cyclohexanecarbonyloxy)-10-[4-(dimethylamino)butanoyloxy]nonadecyl] cyclohexanecarboxylate |
| SMILES | CN(C)CCCC(=O)OC(CCCCCCCCCOC(=O)C1CCCCC1)CCCCCCCCCOC(=O)C1CCCCC1 |
| InChI | InChI=1S/C39H71NO6/c1-40(2)31-23-30-37(41)46-36(28-19-9-5-3-7-11-21-32-44-38(42)34-24-15-13-16-25-34)29-20-10-6-4-8-12-22-33-45-39(43)35-26-17-14-18-27-35/h34-36H,3-33H2,1-2H3 |
| InChIKey | PAOSSKFMSRCTTR-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.00 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|