About [4-[3-amino-1-(4-carbamoylanilino)-1-oxopropan-2-yl]phenyl]methyl 3,5-dichlorobenzoate
[4-[3-amino-1-(4-carbamoylanilino)-1-oxopropan-2-yl]phenyl]methyl 3,5-dichlorobenzoate (PubChem CID 71604105) has the molecular formula C24H21Cl2N3O4
and a molecular weight of 486.36 g/mol. Its IUPAC name is [4-[3-amino-1-(4-carbamoylanilino)-1-oxopropan-2-yl]phenyl]methyl 3,5-dichlorobenzoate.
Molecular Properties
| Compound Name | [4-[3-amino-1-(4-carbamoylanilino)-1-oxopropan-2-yl]phenyl]methyl 3,5-dichlorobenzoate |
| PubChem CID | 71604105 |
| Molecular Formula | C24H21Cl2N3O4 |
| Molecular Weight | 486.36 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | [4-[3-amino-1-(4-carbamoylanilino)-1-oxopropan-2-yl]phenyl]methyl 3,5-dichlorobenzoate |
| SMILES | NCC(C(=O)Nc1ccc(C(N)=O)cc1)c1ccc(COC(=O)c2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C24H21Cl2N3O4/c25-18-9-17(10-19(26)11-18)24(32)33-13-14-1-3-15(4-2-14)21(12-27)23(31)29-20-7-5-16(6-8-20)22(28)30/h1-11,21H,12-13,27H2,(H2,28,30)(H,29,31) |
| InChIKey | VFXILSQOVYXHMV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[3-amino-1-(4-carbamoylanilino)-1-oxopropan-2-yl]phenyl]methyl 3,5-dichlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3-amino-1-(4-carbamoylanilino)-1-oxopropan-2-yl]phenyl]methyl 3,5-dichlorobenzoate?
The IUPAC name of [4-[3-amino-1-(4-carbamoylanilino)-1-oxopropan-2-yl]phenyl]methyl 3,5-dichlorobenzoate (CID 71604105) is [4-[3-amino-1-(4-carbamoylanilino)-1-oxopropan-2-yl]phenyl]methyl 3,5-dichlorobenzoate.
What is the SMILES notation for [4-[3-amino-1-(4-carbamoylanilino)-1-oxopropan-2-yl]phenyl]methyl 3,5-dichlorobenzoate?
The canonical SMILES for [4-[3-amino-1-(4-carbamoylanilino)-1-oxopropan-2-yl]phenyl]methyl 3,5-dichlorobenzoate is NCC(C(=O)Nc1ccc(C(N)=O)cc1)c1ccc(COC(=O)c2cc(Cl)cc(Cl)c2)cc1.
What is the InChIKey of [4-[3-amino-1-(4-carbamoylanilino)-1-oxopropan-2-yl]phenyl]methyl 3,5-dichlorobenzoate?
The InChIKey is VFXILSQOVYXHMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21Cl2N3O4/c25-18-9-17(10-19(26)11-18)24(32)33-13-14-1-3-15(4-2-14)21(12-27)23(31)29-20-7-5-16(6-8-20)22(28)30/h1-11,21H,12-13,27H2,(H2,28,30)(H,29,31).
What are the key properties of [4-[3-amino-1-(4-carbamoylanilino)-1-oxopropan-2-yl]phenyl]methyl 3,5-dichlorobenzoate?
[4-[3-amino-1-(4-carbamoylanilino)-1-oxopropan-2-yl]phenyl]methyl 3,5-dichlorobenzoate has a molecular weight of 486.36 g/mol, XLogP of 4.13, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3-amino-1-(4-carbamoylanilino)-1-oxopropan-2-yl]phenyl]methyl 3,5-dichlorobenzoate is sourced from PubChem (CID 71604105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).