C15H18N6O4 — CID 71606075
(2S,3R,4S)-3-acetamido-4-azido-2-[(2-phenylhydrazinyl)methyl]-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 71606075) has the molecular formula C15H18N6O4 and a molecular weight of 346.35 g/mol. Its IUPAC name is (2S,3R,4S)-3-acetamido-4-azido-2-[(2-phenylhydrazinyl)methyl]-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2S,3R,4S)-3-acetamido-4-azido-2-[(2-phenylhydrazinyl)methyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 71606075 |
| Molecular Formula | C15H18N6O4 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | (2S,3R,4S)-3-acetamido-4-azido-2-[(2-phenylhydrazinyl)methyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | CC(=O)N[C@@H]1[C@@H](N=[N+]=[N-])C=C(C(=O)O)O[C@H]1CNNc1ccccc1 |
| InChI | InChI=1S/C15H18N6O4/c1-9(22)18-14-11(20-21-16)7-12(15(23)24)25-13(14)8-17-19-10-5-3-2-4-6-10/h2-7,11,13-14,17,19H,8H2,1H3,(H,18,22)(H,23,24)/t11-,13-,14+/m0/s1 |
| InChIKey | FWZSENUFOYMLNV-FPMFFAJLSA-N |
| XLogP | 1.15 |
| TPSA | 148.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|