C18H16N4 — CID 71606501
4-N-phenyl-4-N-[(E)-pyridin-2-ylmethylideneamino]benzene-1,4-diamine (PubChem CID 71606501) has the molecular formula C18H16N4 and a molecular weight of 288.35 g/mol. Its IUPAC name is 4-N-phenyl-4-N-[(E)-pyridin-2-ylmethylideneamino]benzene-1,4-diamine.
| Compound Name | 4-N-phenyl-4-N-[(E)-pyridin-2-ylmethylideneamino]benzene-1,4-diamine |
|---|---|
| PubChem CID | 71606501 |
| Molecular Formula | C18H16N4 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 4-N-phenyl-4-N-[(E)-pyridin-2-ylmethylideneamino]benzene-1,4-diamine |
| SMILES | Nc1ccc(N(/N=C/c2ccccn2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H16N4/c19-15-9-11-18(12-10-15)22(17-7-2-1-3-8-17)21-14-16-6-4-5-13-20-16/h1-14H,19H2/b21-14+ |
| InChIKey | OPCUEOWHTGSBHY-KGENOOAVSA-N |
| XLogP | 3.84 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|