C26H33FN6O5S — CID 71609659
tert-butyl N-[4-[[3-[[4-(4-fluoro-2-methoxyphenyl)-1,3,5-triazin-2-yl]amino]phenyl]methylsulfonylamino]butyl]carbamate (PubChem CID 71609659) has the molecular formula C26H33FN6O5S and a molecular weight of 560.65 g/mol. Its IUPAC name is tert-butyl N-[4-[[3-[[4-(4-fluoro-2-methoxyphenyl)-1,3,5-triazin-2-yl]amino]phenyl]methylsulfonylamino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[[3-[[4-(4-fluoro-2-methoxyphenyl)-1,3,5-triazin-2-yl]amino]phenyl]methylsulfonylamino]butyl]carbamate |
|---|---|
| PubChem CID | 71609659 |
| Molecular Formula | C26H33FN6O5S |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | tert-butyl N-[4-[[3-[[4-(4-fluoro-2-methoxyphenyl)-1,3,5-triazin-2-yl]amino]phenyl]methylsulfonylamino]butyl]carbamate |
| SMILES | COc1cc(F)ccc1-c1ncnc(Nc2cccc(CS(=O)(=O)NCCCCNC(=O)OC(C)(C)C)c2)n1 |
| InChI | InChI=1S/C26H33FN6O5S/c1-26(2,3)38-25(34)28-12-5-6-13-31-39(35,36)16-18-8-7-9-20(14-18)32-24-30-17-29-23(33-24)21-11-10-19(27)15-22(21)37-4/h7-11,14-15,17,31H,5-6,12-13,16H2,1-4H3,(H,28,34)(H,29,30,32,33) |
| InChIKey | FHXAIMVXMYIUHB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 144.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|