C20H19FN6O2S — CID 71617805
[ethyl-[[3-[[4-(4-fluoro-2-methoxyphenyl)-1,3,5-triazin-2-yl]amino]phenyl]methyl]-oxo-λ6-sulfanylidene]cyanamide (PubChem CID 71617805) has the molecular formula C20H19FN6O2S and a molecular weight of 426.48 g/mol. Its IUPAC name is [ethyl-[[3-[[4-(4-fluoro-2-methoxyphenyl)-1,3,5-triazin-2-yl]amino]phenyl]methyl]-oxo-λ6-sulfanylidene]cyanamide.
| Compound Name | [ethyl-[[3-[[4-(4-fluoro-2-methoxyphenyl)-1,3,5-triazin-2-yl]amino]phenyl]methyl]-oxo-λ6-sulfanylidene]cyanamide |
|---|---|
| PubChem CID | 71617805 |
| Molecular Formula | C20H19FN6O2S |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | [ethyl-[[3-[[4-(4-fluoro-2-methoxyphenyl)-1,3,5-triazin-2-yl]amino]phenyl]methyl]-oxo-λ6-sulfanylidene]cyanamide |
| SMILES | CCS(=O)(Cc1cccc(Nc2ncnc(-c3ccc(F)cc3OC)n2)c1)=NC#N |
| InChI | InChI=1S/C20H19FN6O2S/c1-3-30(28,25-12-22)11-14-5-4-6-16(9-14)26-20-24-13-23-19(27-20)17-8-7-15(21)10-18(17)29-2/h4-10,13H,3,11H2,1-2H3,(H,23,24,26,27) |
| InChIKey | LYDJRRHXAUQPTD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 113.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|