C32H56N10O5S2 — CID 71611142
N-[8-[(4-isothiocyanatophenyl)carbamothioylamino]-3,6,10,13,16,19-hexazabicyclo[6.6.6]icosan-1-yl]-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanamide (PubChem CID 71611142) has the molecular formula C32H56N10O5S2 and a molecular weight of 725.00 g/mol. Its IUPAC name is N-[8-[(4-isothiocyanatophenyl)carbamothioylamino]-3,6,10,13,16,19-hexazabicyclo[6.6.6]icosan-1-yl]-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanamide.
| Compound Name | N-[8-[(4-isothiocyanatophenyl)carbamothioylamino]-3,6,10,13,16,19-hexazabicyclo[6.6.6]icosan-1-yl]-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanamide |
|---|---|
| PubChem CID | 71611142 |
| Molecular Formula | C32H56N10O5S2 |
| Molecular Weight | 725.00 g/mol |
| Exact Mass | 724.39 |
| IUPAC Name | N-[8-[(4-isothiocyanatophenyl)carbamothioylamino]-3,6,10,13,16,19-hexazabicyclo[6.6.6]icosan-1-yl]-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanamide |
| SMILES | COCCOCCOCCOCCC(=O)NC12CNCCNCC(NC(=S)Nc3ccc(N=C=S)cc3)(CNCCNC1)CNCCNC2 |
| InChI | InChI=1S/C32H56N10O5S2/c1-44-14-15-46-18-19-47-17-16-45-13-6-29(43)41-31-20-33-7-10-36-23-32(24-37-11-8-34-21-31,25-38-12-9-35-22-31)42-30(49)40-28-4-2-27(3-5-28)39-26-48/h2-5,33-38H,6-25H2,1H3,(H,41,43)(H2,40,42,49) |
| InChIKey | WRWPIEAMBSMOHA-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 174.62 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.00 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|