C12H17N3O2S2Si — CID 134966919
1-[3-[dihydroxy(methyl)silyl]propyl]-3-(4-isothiocyanatophenyl)thiourea (PubChem CID 134966919) has the molecular formula C12H17N3O2S2Si and a molecular weight of 327.51 g/mol. Its IUPAC name is 1-[3-[dihydroxy(methyl)silyl]propyl]-3-(4-isothiocyanatophenyl)thiourea.
| Compound Name | 1-[3-[dihydroxy(methyl)silyl]propyl]-3-(4-isothiocyanatophenyl)thiourea |
|---|---|
| PubChem CID | 134966919 |
| Molecular Formula | C12H17N3O2S2Si |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 1-[3-[dihydroxy(methyl)silyl]propyl]-3-(4-isothiocyanatophenyl)thiourea |
| SMILES | C[Si](O)(O)CCCNC(=S)Nc1ccc(N=C=S)cc1 |
| InChI | InChI=1S/C12H17N3O2S2Si/c1-20(16,17)8-2-7-13-12(19)15-11-5-3-10(4-6-11)14-9-18/h3-6,16-17H,2,7-8H2,1H3,(H2,13,15,19) |
| InChIKey | CCDSXGAFWFCHLN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|