C10H11N3S2 — CID 89375970
1-ethyl-3-(4-isothiocyanatophenyl)thiourea (PubChem CID 89375970) has the molecular formula C10H11N3S2 and a molecular weight of 237.35 g/mol. Its IUPAC name is 1-ethyl-3-(4-isothiocyanatophenyl)thiourea.
| Compound Name | 1-ethyl-3-(4-isothiocyanatophenyl)thiourea |
|---|---|
| PubChem CID | 89375970 |
| Molecular Formula | C10H11N3S2 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 1-ethyl-3-(4-isothiocyanatophenyl)thiourea |
| SMILES | CCNC(=S)Nc1ccc(N=C=S)cc1 |
| InChI | InChI=1S/C10H11N3S2/c1-2-11-10(15)13-9-5-3-8(4-6-9)12-7-14/h3-6H,2H2,1H3,(H2,11,13,15) |
| InChIKey | YZMFUMZHYOGZEO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|