C22H26N6S4 — CID 158562097
1,4-diisothiocyanatobenzene;1-(4-isothiocyanatophenyl)-3-propan-2-ylthiourea;propan-2-amine (PubChem CID 158562097) has the molecular formula C22H26N6S4 and a molecular weight of 502.76 g/mol. Its IUPAC name is 1,4-diisothiocyanatobenzene;1-(4-isothiocyanatophenyl)-3-propan-2-ylthiourea;propan-2-amine.
| Compound Name | 1,4-diisothiocyanatobenzene;1-(4-isothiocyanatophenyl)-3-propan-2-ylthiourea;propan-2-amine |
|---|---|
| PubChem CID | 158562097 |
| Molecular Formula | C22H26N6S4 |
| Molecular Weight | 502.76 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | 1,4-diisothiocyanatobenzene;1-(4-isothiocyanatophenyl)-3-propan-2-ylthiourea;propan-2-amine |
| SMILES | CC(C)N.CC(C)NC(=S)Nc1ccc(N=C=S)cc1.S=C=Nc1ccc(N=C=S)cc1 |
| InChI | InChI=1S/C11H13N3S2.C8H4N2S2.C3H9N/c1-8(2)13-11(16)14-10-5-3-9(4-6-10)12-7-15;11-5-9-7-1-2-8(4-3-7)10-6-12;1-3(2)4/h3-6,8H,1-2H3,(H2,13,14,16);1-4H;3H,4H2,1-2H3 |
| InChIKey | HQZXKLPHHWEBIT-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 87.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.76 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|