C17H28FNO5 — CID 178126351
4-[3-[2-(2-methoxyethoxy)ethoxy]propanoylamino]bicyclo[2.2.2]octane-1-carbonyl fluoride (PubChem CID 178126351) has the molecular formula C17H28FNO5 and a molecular weight of 345.41 g/mol. Its IUPAC name is 4-[3-[2-(2-methoxyethoxy)ethoxy]propanoylamino]bicyclo[2.2.2]octane-1-carbonyl fluoride.
| Compound Name | 4-[3-[2-(2-methoxyethoxy)ethoxy]propanoylamino]bicyclo[2.2.2]octane-1-carbonyl fluoride |
|---|---|
| PubChem CID | 178126351 |
| Molecular Formula | C17H28FNO5 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | 4-[3-[2-(2-methoxyethoxy)ethoxy]propanoylamino]bicyclo[2.2.2]octane-1-carbonyl fluoride |
| SMILES | COCCOCCOCCC(=O)NC12CCC(C(=O)F)(CC1)CC2 |
| InChI | InChI=1S/C17H28FNO5/c1-22-10-11-24-13-12-23-9-2-14(20)19-17-6-3-16(4-7-17,5-8-17)15(18)21/h2-13H2,1H3,(H,19,20) |
| InChIKey | XMBAPCYJDKZPFT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|