C20H34KNO5 — CID 177357246
potassium 3-[2-(2-methanidyloxyethoxy)ethoxy]-N-[4-(2-methylpropanoyl)-1-bicyclo[2.2.2]octanyl]propanamide (PubChem CID 177357246) has the molecular formula C20H34KNO5 and a molecular weight of 407.59 g/mol. Its IUPAC name is potassium 3-[2-(2-methanidyloxyethoxy)ethoxy]-N-[4-(2-methylpropanoyl)-1-bicyclo[2.2.2]octanyl]propanamide.
| Compound Name | potassium 3-[2-(2-methanidyloxyethoxy)ethoxy]-N-[4-(2-methylpropanoyl)-1-bicyclo[2.2.2]octanyl]propanamide |
|---|---|
| PubChem CID | 177357246 |
| Molecular Formula | C20H34KNO5 |
| Molecular Weight | 407.59 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | potassium 3-[2-(2-methanidyloxyethoxy)ethoxy]-N-[4-(2-methylpropanoyl)-1-bicyclo[2.2.2]octanyl]propanamide |
| SMILES | [CH2-]OCCOCCOCCC(=O)NC12CCC(C(=O)C(C)C)(CC1)CC2.[K+] |
| InChI | InChI=1S/C20H34NO5.K/c1-16(2)18(23)19-5-8-20(9-6-19,10-7-19)21-17(22)4-11-25-14-15-26-13-12-24-3;/h16H,3-15H2,1-2H3,(H,21,22);/q-1;+1 |
| InChIKey | OQSRBSLSMCREQN-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.59 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|