C27H23NO3 — CID 71613949
(4R)-4-methyl-4-[(E,1R)-3-oxo-1,5-diphenylpent-4-enyl]-2-phenyl-1,3-oxazol-5-one (PubChem CID 71613949) has the molecular formula C27H23NO3 and a molecular weight of 409.49 g/mol. Its IUPAC name is (4R)-4-methyl-4-[(E,1R)-3-oxo-1,5-diphenylpent-4-enyl]-2-phenyl-1,3-oxazol-5-one.
| Compound Name | (4R)-4-methyl-4-[(E,1R)-3-oxo-1,5-diphenylpent-4-enyl]-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 71613949 |
| Molecular Formula | C27H23NO3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | (4R)-4-methyl-4-[(E,1R)-3-oxo-1,5-diphenylpent-4-enyl]-2-phenyl-1,3-oxazol-5-one |
| SMILES | C[C@]1([C@H](CC(=O)/C=C/c2ccccc2)c2ccccc2)N=C(c2ccccc2)OC1=O |
| InChI | InChI=1S/C27H23NO3/c1-27(26(30)31-25(28-27)22-15-9-4-10-16-22)24(21-13-7-3-8-14-21)19-23(29)18-17-20-11-5-2-6-12-20/h2-18,24H,19H2,1H3/b18-17+/t24-,27-/m1/s1 |
| InChIKey | BMPFDLILMPIUOA-NHDLAMRASA-N |
| XLogP | 5.21 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|