C14H15IN2O2 — CID 71614174
methyl (2S,4S)-1-[(S)-cyano(phenyl)methyl]-4-iodopyrrolidine-2-carboxylate (PubChem CID 71614174) has the molecular formula C14H15IN2O2 and a molecular weight of 370.19 g/mol. Its IUPAC name is methyl (2S,4S)-1-[(S)-cyano(phenyl)methyl]-4-iodopyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4S)-1-[(S)-cyano(phenyl)methyl]-4-iodopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 71614174 |
| Molecular Formula | C14H15IN2O2 |
| Molecular Weight | 370.19 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | methyl (2S,4S)-1-[(S)-cyano(phenyl)methyl]-4-iodopyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](I)CN1[C@H](C#N)c1ccccc1 |
| InChI | InChI=1S/C14H15IN2O2/c1-19-14(18)12-7-11(15)9-17(12)13(8-16)10-5-3-2-4-6-10/h2-6,11-13H,7,9H2,1H3/t11-,12-,13+/m0/s1 |
| InChIKey | ZCTBETGSZMCRLA-RWMBFGLXSA-N |
| XLogP | 2.30 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.19 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|