C32H69FO5Si4 — CID 71614256
triethyl-[(2E,3R,4S,5R,6R)-2-(1-fluoroethylidene)-3,5-bis(triethylsilyloxy)-6-(triethylsilyloxymethyl)oxan-4-yl]oxysilane (PubChem CID 71614256) has the molecular formula C32H69FO5Si4 and a molecular weight of 665.24 g/mol. Its IUPAC name is triethyl-[(2E,3R,4S,5R,6R)-2-(1-fluoroethylidene)-3,5-bis(triethylsilyloxy)-6-(triethylsilyloxymethyl)oxan-4-yl]oxysilane.
| Compound Name | triethyl-[(2E,3R,4S,5R,6R)-2-(1-fluoroethylidene)-3,5-bis(triethylsilyloxy)-6-(triethylsilyloxymethyl)oxan-4-yl]oxysilane |
|---|---|
| PubChem CID | 71614256 |
| Molecular Formula | C32H69FO5Si4 |
| Molecular Weight | 665.24 g/mol |
| Exact Mass | 664.42 |
| IUPAC Name | triethyl-[(2E,3R,4S,5R,6R)-2-(1-fluoroethylidene)-3,5-bis(triethylsilyloxy)-6-(triethylsilyloxymethyl)oxan-4-yl]oxysilane |
| SMILES | CC[Si](CC)(CC)OC[C@H]1O/C(=C(\C)F)[C@H](O[Si](CC)(CC)CC)[C@@H](O[Si](CC)(CC)CC)[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C32H69FO5Si4/c1-14-39(15-2,16-3)34-26-28-30(36-40(17-4,18-5)19-6)32(38-42(23-10,24-11)25-12)31(29(35-28)27(13)33)37-41(20-7,21-8)22-9/h28,30-32H,14-26H2,1-13H3/b29-27+/t28-,30-,31+,32+/m1/s1 |
| InChIKey | HNQSXBYCPFWVRC-DCLIUIMXSA-N |
| XLogP | 10.78 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.24 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|