C33H70O5Si4 — CID 11422427
[(2R,3R,4S,5R,6Z)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-prop-2-enylideneoxan-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11422427) has the molecular formula C33H70O5Si4 and a molecular weight of 659.26 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6Z)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-prop-2-enylideneoxan-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3R,4S,5R,6Z)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-prop-2-enylideneoxan-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11422427 |
| Molecular Formula | C33H70O5Si4 |
| Molecular Weight | 659.26 g/mol |
| Exact Mass | 658.43 |
| IUPAC Name | [(2R,3R,4S,5R,6Z)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-prop-2-enylideneoxan-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=C/C=C1\O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H70O5Si4/c1-22-23-25-27(36-40(16,17)31(5,6)7)29(38-42(20,21)33(11,12)13)28(37-41(18,19)32(8,9)10)26(35-25)24-34-39(14,15)30(2,3)4/h22-23,26-29H,1,24H2,2-21H3/b25-23-/t26-,27+,28-,29-/m1/s1 |
| InChIKey | JTURKDLPAAATKE-NZYBUWMMSA-N |
| XLogP | 10.65 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.26 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|