C43H92O5Si4 — CID 11308824
4-[(2R,3R,4R)-3,4-bis[tri(propan-2-yl)silyloxy]-2-[tri(propan-2-yl)silyloxymethyl]-3,4-dihydro-2H-pyran-6-yl]butoxy-tert-butyl-dimethylsilane (PubChem CID 11308824) has the molecular formula C43H92O5Si4 and a molecular weight of 801.55 g/mol. Its IUPAC name is 4-[(2R,3R,4R)-3,4-bis[tri(propan-2-yl)silyloxy]-2-[tri(propan-2-yl)silyloxymethyl]-3,4-dihydro-2H-pyran-6-yl]butoxy-tert-butyl-dimethylsilane.
| Compound Name | 4-[(2R,3R,4R)-3,4-bis[tri(propan-2-yl)silyloxy]-2-[tri(propan-2-yl)silyloxymethyl]-3,4-dihydro-2H-pyran-6-yl]butoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11308824 |
| Molecular Formula | C43H92O5Si4 |
| Molecular Weight | 801.55 g/mol |
| Exact Mass | 800.60 |
| IUPAC Name | 4-[(2R,3R,4R)-3,4-bis[tri(propan-2-yl)silyloxy]-2-[tri(propan-2-yl)silyloxymethyl]-3,4-dihydro-2H-pyran-6-yl]butoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)[Si](OC[C@H]1OC(CCCCO[Si](C)(C)C(C)(C)C)=C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1O[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C43H92O5Si4/c1-30(2)50(31(3)4,32(5)6)45-29-41-42(48-52(36(13)14,37(15)16)38(17)18)40(47-51(33(7)8,34(9)10)35(11)12)28-39(46-41)26-24-25-27-44-49(22,23)43(19,20)21/h28,30-38,40-42H,24-27,29H2,1-23H3/t40-,41-,42+/m1/s1 |
| InChIKey | MFRLAEFETDOFJR-UJYRSYRGSA-N |
| XLogP | 14.77 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.55 |
| LogP ≤ 5 | 14.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|