C31H67FO5Si4 — CID 102198592
triethyl-[(2Z,3R,4S,5R,6R)-2-(fluoromethylidene)-3,5-bis(triethylsilyloxy)-6-(triethylsilyloxymethyl)oxan-4-yl]oxysilane (PubChem CID 102198592) has the molecular formula C31H67FO5Si4 and a molecular weight of 651.21 g/mol. Its IUPAC name is triethyl-[(2Z,3R,4S,5R,6R)-2-(fluoromethylidene)-3,5-bis(triethylsilyloxy)-6-(triethylsilyloxymethyl)oxan-4-yl]oxysilane.
| Compound Name | triethyl-[(2Z,3R,4S,5R,6R)-2-(fluoromethylidene)-3,5-bis(triethylsilyloxy)-6-(triethylsilyloxymethyl)oxan-4-yl]oxysilane |
|---|---|
| PubChem CID | 102198592 |
| Molecular Formula | C31H67FO5Si4 |
| Molecular Weight | 651.21 g/mol |
| Exact Mass | 650.40 |
| IUPAC Name | triethyl-[(2Z,3R,4S,5R,6R)-2-(fluoromethylidene)-3,5-bis(triethylsilyloxy)-6-(triethylsilyloxymethyl)oxan-4-yl]oxysilane |
| SMILES | CC[Si](CC)(CC)OC[C@H]1O/C(=C\F)[C@H](O[Si](CC)(CC)CC)[C@@H](O[Si](CC)(CC)CC)[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C31H67FO5Si4/c1-13-38(14-2,15-3)33-26-28-30(36-40(19-7,20-8)21-9)31(37-41(22-10,23-11)24-12)29(27(25-32)34-28)35-39(16-4,17-5)18-6/h25,28-31H,13-24,26H2,1-12H3/b27-25-/t28-,29+,30-,31-/m1/s1 |
| InChIKey | GWZOJLNAQHRENF-YIAONSGWSA-N |
| XLogP | 10.39 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.21 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|