C22H34F2N2O2 — CID 71616130
4-butoxy-N-[[1-(dimethylamino)-4,4-difluorocyclohexyl]methyl]-3,5-dimethylbenzamide (PubChem CID 71616130) has the molecular formula C22H34F2N2O2 and a molecular weight of 396.52 g/mol. Its IUPAC name is 4-butoxy-N-[[1-(dimethylamino)-4,4-difluorocyclohexyl]methyl]-3,5-dimethylbenzamide.
| Compound Name | 4-butoxy-N-[[1-(dimethylamino)-4,4-difluorocyclohexyl]methyl]-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 71616130 |
| Molecular Formula | C22H34F2N2O2 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 4-butoxy-N-[[1-(dimethylamino)-4,4-difluorocyclohexyl]methyl]-3,5-dimethylbenzamide |
| SMILES | CCCCOc1c(C)cc(C(=O)NCC2(N(C)C)CCC(F)(F)CC2)cc1C |
| InChI | InChI=1S/C22H34F2N2O2/c1-6-7-12-28-19-16(2)13-18(14-17(19)3)20(27)25-15-21(26(4)5)8-10-22(23,24)11-9-21/h13-14H,6-12,15H2,1-5H3,(H,25,27) |
| InChIKey | NMBQZUOFFKIMQU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|