C18H20N2O6S2 — CID 7161685
methyl (2R)-4-(4-methoxybenzoyl)-1-thiophen-2-ylsulfonylpiperazine-2-carboxylate (PubChem CID 7161685) has the molecular formula C18H20N2O6S2 and a molecular weight of 424.50 g/mol. Its IUPAC name is methyl (2R)-4-(4-methoxybenzoyl)-1-thiophen-2-ylsulfonylpiperazine-2-carboxylate.
| Compound Name | methyl (2R)-4-(4-methoxybenzoyl)-1-thiophen-2-ylsulfonylpiperazine-2-carboxylate |
|---|---|
| PubChem CID | 7161685 |
| Molecular Formula | C18H20N2O6S2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | methyl (2R)-4-(4-methoxybenzoyl)-1-thiophen-2-ylsulfonylpiperazine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CN(C(=O)c2ccc(OC)cc2)CCN1S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C18H20N2O6S2/c1-25-14-7-5-13(6-8-14)17(21)19-9-10-20(15(12-19)18(22)26-2)28(23,24)16-4-3-11-27-16/h3-8,11,15H,9-10,12H2,1-2H3/t15-/m1/s1 |
| InChIKey | MSZIODBEJPYEIB-OAHLLOKOSA-N |
| XLogP | 1.45 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |