C22H22BN5O3 — CID 71617236
[(1R)-2-naphthalen-2-yl-1-[3-(1-pyridin-3-yltriazol-4-yl)propanoylamino]ethyl]boronic acid (PubChem CID 71617236) has the molecular formula C22H22BN5O3 and a molecular weight of 415.26 g/mol. Its IUPAC name is [(1R)-2-naphthalen-2-yl-1-[3-(1-pyridin-3-yltriazol-4-yl)propanoylamino]ethyl]boronic acid.
| Compound Name | [(1R)-2-naphthalen-2-yl-1-[3-(1-pyridin-3-yltriazol-4-yl)propanoylamino]ethyl]boronic acid |
|---|---|
| PubChem CID | 71617236 |
| Molecular Formula | C22H22BN5O3 |
| Molecular Weight | 415.26 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | [(1R)-2-naphthalen-2-yl-1-[3-(1-pyridin-3-yltriazol-4-yl)propanoylamino]ethyl]boronic acid |
| SMILES | O=C(CCc1cn(-c2cccnc2)nn1)N[C@@H](Cc1ccc2ccccc2c1)B(O)O |
| InChI | InChI=1S/C22H22BN5O3/c29-22(10-9-19-15-28(27-26-19)20-6-3-11-24-14-20)25-21(23(30)31)13-16-7-8-17-4-1-2-5-18(17)12-16/h1-8,11-12,14-15,21,30-31H,9-10,13H2,(H,25,29)/t21-/m0/s1 |
| InChIKey | DPHCEZODEWEDGW-NRFANRHFSA-N |
| XLogP | 1.49 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|