C24H25BN4O3S — CID 78127536
[1-[[2-benzyl-3-(1-phenyltriazol-4-yl)propanoyl]amino]-2-thiophen-3-ylethyl]boronic acid (PubChem CID 78127536) has the molecular formula C24H25BN4O3S and a molecular weight of 460.37 g/mol. Its IUPAC name is [1-[[2-benzyl-3-(1-phenyltriazol-4-yl)propanoyl]amino]-2-thiophen-3-ylethyl]boronic acid.
| Compound Name | [1-[[2-benzyl-3-(1-phenyltriazol-4-yl)propanoyl]amino]-2-thiophen-3-ylethyl]boronic acid |
|---|---|
| PubChem CID | 78127536 |
| Molecular Formula | C24H25BN4O3S |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | [1-[[2-benzyl-3-(1-phenyltriazol-4-yl)propanoyl]amino]-2-thiophen-3-ylethyl]boronic acid |
| SMILES | O=C(NC(Cc1ccsc1)B(O)O)C(Cc1ccccc1)Cc1cn(-c2ccccc2)nn1 |
| InChI | InChI=1S/C24H25BN4O3S/c30-24(26-23(25(31)32)14-19-11-12-33-17-19)20(13-18-7-3-1-4-8-18)15-21-16-29(28-27-21)22-9-5-2-6-10-22/h1-12,16-17,20,23,31-32H,13-15H2,(H,26,30) |
| InChIKey | JOTMSQBFAQJTFA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|