C15H23Cl2N3O — CID 71617932
N'-(3,5-dichloro-4-pyridinyl)decanehydrazide (PubChem CID 71617932) has the molecular formula C15H23Cl2N3O and a molecular weight of 332.27 g/mol. Its IUPAC name is N'-(3,5-dichloro-4-pyridinyl)decanehydrazide.
| Compound Name | N'-(3,5-dichloro-4-pyridinyl)decanehydrazide |
|---|---|
| PubChem CID | 71617932 |
| Molecular Formula | C15H23Cl2N3O |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | N'-(3,5-dichloro-4-pyridinyl)decanehydrazide |
| SMILES | CCCCCCCCCC(=O)NNc1c(Cl)cncc1Cl |
| InChI | InChI=1S/C15H23Cl2N3O/c1-2-3-4-5-6-7-8-9-14(21)19-20-15-12(16)10-18-11-13(15)17/h10-11H,2-9H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | VXFOBFDPVHWIKF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|