C19H21NO4 — CID 71618577
(2E)-2-[(3-methoxy-1,4-dioxonaphthalen-2-yl)methylidene]-N,N-dimethylpentanamide (PubChem CID 71618577) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is (2E)-2-[(3-methoxy-1,4-dioxonaphthalen-2-yl)methylidene]-N,N-dimethylpentanamide.
| Compound Name | (2E)-2-[(3-methoxy-1,4-dioxonaphthalen-2-yl)methylidene]-N,N-dimethylpentanamide |
|---|---|
| PubChem CID | 71618577 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (2E)-2-[(3-methoxy-1,4-dioxonaphthalen-2-yl)methylidene]-N,N-dimethylpentanamide |
| SMILES | CCC/C(=C\C1=C(OC)C(=O)c2ccccc2C1=O)C(=O)N(C)C |
| InChI | InChI=1S/C19H21NO4/c1-5-8-12(19(23)20(2)3)11-15-16(21)13-9-6-7-10-14(13)17(22)18(15)24-4/h6-7,9-11H,5,8H2,1-4H3/b12-11+ |
| InChIKey | GMCKRWAXPUGZQH-VAWYXSNFSA-N |
| XLogP | 2.78 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|