C18H14Cl2N4O3 — CID 71622459
methyl N-[4-[3-carbamoyl-4-(2-chlorophenyl)pyrrol-1-yl]-5-chloro-2-pyridinyl]carbamate (PubChem CID 71622459) has the molecular formula C18H14Cl2N4O3 and a molecular weight of 405.24 g/mol. Its IUPAC name is methyl N-[4-[3-carbamoyl-4-(2-chlorophenyl)pyrrol-1-yl]-5-chloro-2-pyridinyl]carbamate.
| Compound Name | methyl N-[4-[3-carbamoyl-4-(2-chlorophenyl)pyrrol-1-yl]-5-chloro-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 71622459 |
| Molecular Formula | C18H14Cl2N4O3 |
| Molecular Weight | 405.24 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | methyl N-[4-[3-carbamoyl-4-(2-chlorophenyl)pyrrol-1-yl]-5-chloro-2-pyridinyl]carbamate |
| SMILES | COC(=O)Nc1cc(-n2cc(C(N)=O)c(-c3ccccc3Cl)c2)c(Cl)cn1 |
| InChI | InChI=1S/C18H14Cl2N4O3/c1-27-18(26)23-16-6-15(14(20)7-22-16)24-8-11(12(9-24)17(21)25)10-4-2-3-5-13(10)19/h2-9H,1H3,(H2,21,25)(H,22,23,26) |
| InChIKey | KZIGSVJENQDWEY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.24 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |