C19H17ClN6O — CID 123643754
N-[4-[3-(2-chlorophenyl)-4-(N'-methanimidoylcarbamimidoyl)pyrrol-1-yl]-2-pyridinyl]acetamide (PubChem CID 123643754) has the molecular formula C19H17ClN6O and a molecular weight of 380.84 g/mol. Its IUPAC name is N-[4-[3-(2-chlorophenyl)-4-(N'-methanimidoylcarbamimidoyl)pyrrol-1-yl]-2-pyridinyl]acetamide.
| Compound Name | N-[4-[3-(2-chlorophenyl)-4-(N'-methanimidoylcarbamimidoyl)pyrrol-1-yl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 123643754 |
| Molecular Formula | C19H17ClN6O |
| Molecular Weight | 380.84 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-[4-[3-(2-chlorophenyl)-4-(N'-methanimidoylcarbamimidoyl)pyrrol-1-yl]-2-pyridinyl]acetamide |
| SMILES | [H]/N=C/N=C(\N)c1cn(-c2ccnc(NC(C)=O)c2)cc1-c1ccccc1Cl |
| InChI | InChI=1S/C19H17ClN6O/c1-12(27)25-18-8-13(6-7-23-18)26-9-15(14-4-2-3-5-17(14)20)16(10-26)19(22)24-11-21/h2-11H,1H3,(H3,21,22,24)(H,23,25,27) |
| InChIKey | ZVDNLDGNBGMLSH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.84 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|