C22H26Cl2N4O — CID 5328723
3-(2,6-dichlorophenyl)-7-[4-(diethylamino)butylamino]-1H-1,6-naphthyridin-2-one (PubChem CID 5328723) has the molecular formula C22H26Cl2N4O and a molecular weight of 433.38 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-7-[4-(diethylamino)butylamino]-1H-1,6-naphthyridin-2-one.
| Compound Name | 3-(2,6-dichlorophenyl)-7-[4-(diethylamino)butylamino]-1H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 5328723 |
| Molecular Formula | C22H26Cl2N4O |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-7-[4-(diethylamino)butylamino]-1H-1,6-naphthyridin-2-one |
| SMILES | CCN(CC)CCCCNc1cc2[nH]c(=O)c(-c3c(Cl)cccc3Cl)cc2cn1 |
| InChI | InChI=1S/C22H26Cl2N4O/c1-3-28(4-2)11-6-5-10-25-20-13-19-15(14-26-20)12-16(22(29)27-19)21-17(23)8-7-9-18(21)24/h7-9,12-14H,3-6,10-11H2,1-2H3,(H,25,26)(H,27,29) |
| InChIKey | OMTMSMIIXGDMJB-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|