C50H70N4S4 — CID 71623557
2-[11-(dicyanomethylidene)-5,12-bis(3-hexylundecyl)-3,7,10,14-tetrathiatetracyclo[6.6.0.02,6.09,13]tetradeca-1,5,8,12-tetraen-4-ylidene]propanedinitrile (PubChem CID 71623557) has the molecular formula C50H70N4S4 and a molecular weight of 855.41 g/mol. Its IUPAC name is 2-[11-(dicyanomethylidene)-5,12-bis(3-hexylundecyl)-3,7,10,14-tetrathiatetracyclo[6.6.0.02,6.09,13]tetradeca-1,5,8,12-tetraen-4-ylidene]propanedinitrile.
| Compound Name | 2-[11-(dicyanomethylidene)-5,12-bis(3-hexylundecyl)-3,7,10,14-tetrathiatetracyclo[6.6.0.02,6.09,13]tetradeca-1,5,8,12-tetraen-4-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 71623557 |
| Molecular Formula | C50H70N4S4 |
| Molecular Weight | 855.41 g/mol |
| Exact Mass | 854.45 |
| IUPAC Name | 2-[11-(dicyanomethylidene)-5,12-bis(3-hexylundecyl)-3,7,10,14-tetrathiatetracyclo[6.6.0.02,6.09,13]tetradeca-1,5,8,12-tetraen-4-ylidene]propanedinitrile |
| SMILES | CCCCCCCCC(CCCCCC)CCc1c(=C(C#N)C#N)sc2c1sc1c3sc(=C(C#N)C#N)c(CCC(CCCCCC)CCCCCCCC)c3sc21 |
| InChI | InChI=1S/C50H70N4S4/c1-5-9-13-17-19-23-27-37(25-21-15-11-7-3)29-31-41-43(39(33-51)34-52)55-47-45(41)57-50-48-46(58-49(47)50)42(44(56-48)40(35-53)36-54)32-30-38(26-22-16-12-8-4)28-24-20-18-14-10-6-2/h37-38H,5-32H2,1-4H3 |
| InChIKey | XOVXQSNWDQUXJN-UHFFFAOYSA-N |
| XLogP | 16.33 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.41 |
| LogP ≤ 5 | 16.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|