C27H46O5Si — CID 71623569
tert-butyl [(2S,3S)-3-[(3E,7E)-11-hydroxy-3,8-dimethyl-13-trimethylsilyltrideca-3,7-dien-12-ynyl]-2-methyloxiran-2-yl]methyl carbonate (PubChem CID 71623569) has the molecular formula C27H46O5Si and a molecular weight of 478.75 g/mol. Its IUPAC name is tert-butyl [(2S,3S)-3-[(3E,7E)-11-hydroxy-3,8-dimethyl-13-trimethylsilyltrideca-3,7-dien-12-ynyl]-2-methyloxiran-2-yl]methyl carbonate.
| Compound Name | tert-butyl [(2S,3S)-3-[(3E,7E)-11-hydroxy-3,8-dimethyl-13-trimethylsilyltrideca-3,7-dien-12-ynyl]-2-methyloxiran-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 71623569 |
| Molecular Formula | C27H46O5Si |
| Molecular Weight | 478.75 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | tert-butyl [(2S,3S)-3-[(3E,7E)-11-hydroxy-3,8-dimethyl-13-trimethylsilyltrideca-3,7-dien-12-ynyl]-2-methyloxiran-2-yl]methyl carbonate |
| SMILES | C/C(=C\CC/C=C(\C)CC[C@@H]1O[C@@]1(C)COC(=O)OC(C)(C)C)CCC(O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C27H46O5Si/c1-21(14-16-23(28)18-19-33(7,8)9)12-10-11-13-22(2)15-17-24-27(6,31-24)20-30-25(29)32-26(3,4)5/h12-13,23-24,28H,10-11,14-17,20H2,1-9H3/b21-12+,22-13+/t23?,24-,27-/m0/s1 |
| InChIKey | MXTSXSOTFNTUOX-VBKDTXCASA-N |
| XLogP | 6.57 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.75 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|