C28H52O5Si — CID 71623568
tert-butyl [(2S,3S)-3-[(3E,7E)-11-[tert-butyl(dimethyl)silyl]oxy-3,8-dimethylundeca-3,7-dienyl]-2-methyloxiran-2-yl]methyl carbonate (PubChem CID 71623568) has the molecular formula C28H52O5Si and a molecular weight of 496.81 g/mol. Its IUPAC name is tert-butyl [(2S,3S)-3-[(3E,7E)-11-[tert-butyl(dimethyl)silyl]oxy-3,8-dimethylundeca-3,7-dienyl]-2-methyloxiran-2-yl]methyl carbonate.
| Compound Name | tert-butyl [(2S,3S)-3-[(3E,7E)-11-[tert-butyl(dimethyl)silyl]oxy-3,8-dimethylundeca-3,7-dienyl]-2-methyloxiran-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 71623568 |
| Molecular Formula | C28H52O5Si |
| Molecular Weight | 496.81 g/mol |
| Exact Mass | 496.36 |
| IUPAC Name | tert-butyl [(2S,3S)-3-[(3E,7E)-11-[tert-butyl(dimethyl)silyl]oxy-3,8-dimethylundeca-3,7-dienyl]-2-methyloxiran-2-yl]methyl carbonate |
| SMILES | C/C(=C\CC/C=C(\C)CC[C@@H]1O[C@@]1(C)COC(=O)OC(C)(C)C)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H52O5Si/c1-22(17-14-20-31-34(10,11)27(6,7)8)15-12-13-16-23(2)18-19-24-28(9,32-24)21-30-25(29)33-26(3,4)5/h15-16,24H,12-14,17-21H2,1-11H3/b22-15+,23-16+/t24-,28-/m0/s1 |
| InChIKey | OGLHRHOHJKQGRQ-MVOPMOBNSA-N |
| XLogP | 8.35 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.81 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|