C19H36O4Si — CID 23241047
[(Z)-6-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)-4-(trimethylsilylmethyl)hex-3-enyl] acetate (PubChem CID 23241047) has the molecular formula C19H36O4Si and a molecular weight of 356.58 g/mol. Its IUPAC name is [(Z)-6-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)-4-(trimethylsilylmethyl)hex-3-enyl] acetate.
| Compound Name | [(Z)-6-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)-4-(trimethylsilylmethyl)hex-3-enyl] acetate |
|---|---|
| PubChem CID | 23241047 |
| Molecular Formula | C19H36O4Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | [(Z)-6-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)-4-(trimethylsilylmethyl)hex-3-enyl] acetate |
| SMILES | CC(=O)OCC/C=C(/CCC1OC(C)(C)OC1(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C19H36O4Si/c1-15(20)21-13-9-10-16(14-24(6,7)8)11-12-17-18(2,3)23-19(4,5)22-17/h10,17H,9,11-14H2,1-8H3/b16-10- |
| InChIKey | TWILOAUYMQQTPK-YBEGLDIGSA-N |
| XLogP | 4.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|