C23H42O4Si — CID 127054613
tert-butyl-[(2E,6E)-9-[(2S)-3,3-dimethyloxiran-2-yl]-1-(1,3-dioxolan-2-yl)-7-methylnona-2,6-dien-3-yl]oxy-dimethylsilane (PubChem CID 127054613) has the molecular formula C23H42O4Si and a molecular weight of 410.67 g/mol. Its IUPAC name is tert-butyl-[(2E,6E)-9-[(2S)-3,3-dimethyloxiran-2-yl]-1-(1,3-dioxolan-2-yl)-7-methylnona-2,6-dien-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2E,6E)-9-[(2S)-3,3-dimethyloxiran-2-yl]-1-(1,3-dioxolan-2-yl)-7-methylnona-2,6-dien-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 127054613 |
| Molecular Formula | C23H42O4Si |
| Molecular Weight | 410.67 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | tert-butyl-[(2E,6E)-9-[(2S)-3,3-dimethyloxiran-2-yl]-1-(1,3-dioxolan-2-yl)-7-methylnona-2,6-dien-3-yl]oxy-dimethylsilane |
| SMILES | C/C(=C\CC/C(=C\CC1OCCO1)O[Si](C)(C)C(C)(C)C)CC[C@@H]1OC1(C)C |
| InChI | InChI=1S/C23H42O4Si/c1-18(12-14-20-23(5,6)26-20)10-9-11-19(13-15-21-24-16-17-25-21)27-28(7,8)22(2,3)4/h10,13,20-21H,9,11-12,14-17H2,1-8H3/b18-10+,19-13+/t20-/m0/s1 |
| InChIKey | HRVJUACGVORFLQ-OWNDRHNHSA-N |
| XLogP | 6.34 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.67 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|