C22H44O3Si — CID 132551502
tert-butyl-dimethyl-[(E,2R)-6-methyl-8-[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]oct-5-en-2-yl]oxysilane (PubChem CID 132551502) has the molecular formula C22H44O3Si and a molecular weight of 384.68 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E,2R)-6-methyl-8-[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]oct-5-en-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(E,2R)-6-methyl-8-[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]oct-5-en-2-yl]oxysilane |
|---|---|
| PubChem CID | 132551502 |
| Molecular Formula | C22H44O3Si |
| Molecular Weight | 384.68 g/mol |
| Exact Mass | 384.31 |
| IUPAC Name | tert-butyl-dimethyl-[(E,2R)-6-methyl-8-[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]oct-5-en-2-yl]oxysilane |
| SMILES | C/C(=C\CC[C@@H](C)O[Si](C)(C)C(C)(C)C)CC[C@@H]1OC(C)(C)OC1(C)C |
| InChI | InChI=1S/C22H44O3Si/c1-17(15-16-19-21(6,7)25-22(8,9)23-19)13-12-14-18(2)24-26(10,11)20(3,4)5/h13,18-19H,12,14-16H2,1-11H3/b17-13+/t18-,19+/m1/s1 |
| InChIKey | DECMZQLJDVDKFP-XRYNCONFSA-N |
| XLogP | 6.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.68 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|