C24H46O3Si — CID 14657946
tert-butyl-[(2E,6E)-10-(1,3-dioxolan-2-yl)-3,7,11-trimethyldodeca-2,6-dienoxy]-dimethylsilane (PubChem CID 14657946) has the molecular formula C24H46O3Si and a molecular weight of 410.72 g/mol. Its IUPAC name is tert-butyl-[(2E,6E)-10-(1,3-dioxolan-2-yl)-3,7,11-trimethyldodeca-2,6-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2E,6E)-10-(1,3-dioxolan-2-yl)-3,7,11-trimethyldodeca-2,6-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 14657946 |
| Molecular Formula | C24H46O3Si |
| Molecular Weight | 410.72 g/mol |
| Exact Mass | 410.32 |
| IUPAC Name | tert-butyl-[(2E,6E)-10-(1,3-dioxolan-2-yl)-3,7,11-trimethyldodeca-2,6-dienoxy]-dimethylsilane |
| SMILES | C/C(=C\CO[Si](C)(C)C(C)(C)C)CC/C=C(\C)CCC(C(C)C)C1OCCO1 |
| InChI | InChI=1S/C24H46O3Si/c1-19(2)22(23-25-17-18-26-23)14-13-20(3)11-10-12-21(4)15-16-27-28(8,9)24(5,6)7/h11,15,19,22-23H,10,12-14,16-18H2,1-9H3/b20-11+,21-15+ |
| InChIKey | BGJHUVBAGOEHNX-JAGDBARYSA-N |
| XLogP | 7.11 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.72 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|