C34H64O8Si2 — CID 11961850
[(2R,3R)-4-[(1S,3S,4E,8Z)-3,10-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-4,8-dimethyldeca-4,8-dienyl]-2-[(1S)-1-hydroxy-2-methylpropyl]-5-oxooxolan-3-yl] acetate (PubChem CID 11961850) has the molecular formula C34H64O8Si2 and a molecular weight of 657.05 g/mol. Its IUPAC name is [(2R,3R)-4-[(1S,3S,4E,8Z)-3,10-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-4,8-dimethyldeca-4,8-dienyl]-2-[(1S)-1-hydroxy-2-methylpropyl]-5-oxooxolan-3-yl] acetate.
| Compound Name | [(2R,3R)-4-[(1S,3S,4E,8Z)-3,10-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-4,8-dimethyldeca-4,8-dienyl]-2-[(1S)-1-hydroxy-2-methylpropyl]-5-oxooxolan-3-yl] acetate |
|---|---|
| PubChem CID | 11961850 |
| Molecular Formula | C34H64O8Si2 |
| Molecular Weight | 657.05 g/mol |
| Exact Mass | 656.41 |
| IUPAC Name | [(2R,3R)-4-[(1S,3S,4E,8Z)-3,10-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-4,8-dimethyldeca-4,8-dienyl]-2-[(1S)-1-hydroxy-2-methylpropyl]-5-oxooxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C([C@@H](O)C[C@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/CC/C(C)=C\CO[Si](C)(C)C(C)(C)C)C(=O)O[C@@H]1[C@@H](O)C(C)C |
| InChI | InChI=1S/C34H64O8Si2/c1-22(2)29(37)31-30(40-25(5)35)28(32(38)41-31)26(36)21-27(42-44(14,15)34(9,10)11)24(4)18-16-17-23(3)19-20-39-43(12,13)33(6,7)8/h18-19,22,26-31,36-37H,16-17,20-21H2,1-15H3/b23-19-,24-18+/t26-,27-,28?,29-,30+,31+/m0/s1 |
| InChIKey | XUQFEDZLMKNLTL-RMUZDPKZSA-N |
| XLogP | 7.31 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.05 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|