C26H48O5Si — CID 135024075
tert-butyl [(2S,3S)-3-[(3E,7E)-9-[tert-butyl(dimethyl)silyl]oxy-3,8-dimethylnona-3,7-dienyl]-2-methyloxiran-2-yl]methyl carbonate (PubChem CID 135024075) has the molecular formula C26H48O5Si and a molecular weight of 468.75 g/mol. Its IUPAC name is tert-butyl [(2S,3S)-3-[(3E,7E)-9-[tert-butyl(dimethyl)silyl]oxy-3,8-dimethylnona-3,7-dienyl]-2-methyloxiran-2-yl]methyl carbonate.
| Compound Name | tert-butyl [(2S,3S)-3-[(3E,7E)-9-[tert-butyl(dimethyl)silyl]oxy-3,8-dimethylnona-3,7-dienyl]-2-methyloxiran-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 135024075 |
| Molecular Formula | C26H48O5Si |
| Molecular Weight | 468.75 g/mol |
| Exact Mass | 468.33 |
| IUPAC Name | tert-butyl [(2S,3S)-3-[(3E,7E)-9-[tert-butyl(dimethyl)silyl]oxy-3,8-dimethylnona-3,7-dienyl]-2-methyloxiran-2-yl]methyl carbonate |
| SMILES | C/C(=C\CC/C=C(\C)CO[Si](C)(C)C(C)(C)C)CC[C@@H]1O[C@@]1(C)COC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H48O5Si/c1-20(14-12-13-15-21(2)18-29-32(10,11)25(6,7)8)16-17-22-26(9,30-22)19-28-23(27)31-24(3,4)5/h14-15,22H,12-13,16-19H2,1-11H3/b20-14+,21-15+/t22-,26-/m0/s1 |
| InChIKey | MTLIWVKDSZVUTJ-NEARPWIXSA-N |
| XLogP | 7.57 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.75 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|