C18H34O4Si — CID 102574029
[(E)-5-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxiran-2-yl]-3-methylpent-2-enyl] acetate (PubChem CID 102574029) has the molecular formula C18H34O4Si and a molecular weight of 342.55 g/mol. Its IUPAC name is [(E)-5-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxiran-2-yl]-3-methylpent-2-enyl] acetate.
| Compound Name | [(E)-5-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxiran-2-yl]-3-methylpent-2-enyl] acetate |
|---|---|
| PubChem CID | 102574029 |
| Molecular Formula | C18H34O4Si |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | [(E)-5-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxiran-2-yl]-3-methylpent-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CCC1OC1(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H34O4Si/c1-14(11-12-20-15(2)19)9-10-16-18(6,22-16)13-21-23(7,8)17(3,4)5/h11,16H,9-10,12-13H2,1-8H3/b14-11+ |
| InChIKey | WNJPJQIWUSOZDY-SDNWHVSQSA-N |
| XLogP | 4.46 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|