C15H23Cl3O13 — CID 71623697
[(2R,3S,4S,5R,6R)-6-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 2,2,2-trichloroethyl carbonate (PubChem CID 71623697) has the molecular formula C15H23Cl3O13 and a molecular weight of 517.70 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-6-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 2,2,2-trichloroethyl carbonate.
| Compound Name | [(2R,3S,4S,5R,6R)-6-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 2,2,2-trichloroethyl carbonate |
|---|---|
| PubChem CID | 71623697 |
| Molecular Formula | C15H23Cl3O13 |
| Molecular Weight | 517.70 g/mol |
| Exact Mass | 516.02 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-6-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 2,2,2-trichloroethyl carbonate |
| SMILES | O=C(OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H23Cl3O13/c16-15(17,18)4-28-13(26)27-2-6-7(21)9(23)10(24)12(29-6)31-14(3-20)11(25)8(22)5(1-19)30-14/h5-12,19-25H,1-4H2/t5-,6-,7-,8-,9+,10-,11+,12-,14+/m1/s1 |
| InChIKey | CESSSKZZMRZCPK-RSWOSACBSA-N |
| XLogP | -2.86 |
| TPSA | 204.83 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.70 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|