C26H19N3OS — CID 71625055
4-[5-(1-methyl-4-oxo-3-phenyl-2H-quinazolin-2-yl)thiophen-2-yl]benzonitrile (PubChem CID 71625055) has the molecular formula C26H19N3OS and a molecular weight of 421.53 g/mol. Its IUPAC name is 4-[5-(1-methyl-4-oxo-3-phenyl-2H-quinazolin-2-yl)thiophen-2-yl]benzonitrile.
| Compound Name | 4-[5-(1-methyl-4-oxo-3-phenyl-2H-quinazolin-2-yl)thiophen-2-yl]benzonitrile |
|---|---|
| PubChem CID | 71625055 |
| Molecular Formula | C26H19N3OS |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 4-[5-(1-methyl-4-oxo-3-phenyl-2H-quinazolin-2-yl)thiophen-2-yl]benzonitrile |
| SMILES | CN1c2ccccc2C(=O)N(c2ccccc2)C1c1ccc(-c2ccc(C#N)cc2)s1 |
| InChI | InChI=1S/C26H19N3OS/c1-28-22-10-6-5-9-21(22)26(30)29(20-7-3-2-4-8-20)25(28)24-16-15-23(31-24)19-13-11-18(17-27)12-14-19/h2-16,25H,1H3 |
| InChIKey | SPFJDFRPFTWOKP-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |