C15H12ClF3N2O4S — CID 71626628
4-[4-chloro-3-(trifluoromethyl)phenoxy]-N-(methylsulfamoyl)benzamide (PubChem CID 71626628) has the molecular formula C15H12ClF3N2O4S and a molecular weight of 408.79 g/mol. Its IUPAC name is 4-[4-chloro-3-(trifluoromethyl)phenoxy]-N-(methylsulfamoyl)benzamide.
| Compound Name | 4-[4-chloro-3-(trifluoromethyl)phenoxy]-N-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 71626628 |
| Molecular Formula | C15H12ClF3N2O4S |
| Molecular Weight | 408.79 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | 4-[4-chloro-3-(trifluoromethyl)phenoxy]-N-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)NC(=O)c1ccc(Oc2ccc(Cl)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C15H12ClF3N2O4S/c1-20-26(23,24)21-14(22)9-2-4-10(5-3-9)25-11-6-7-13(16)12(8-11)15(17,18)19/h2-8,20H,1H3,(H,21,22) |
| InChIKey | SWWZZIGQDDYMOQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.79 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |