C10H13N3O4S — CID 71635609
3-nitro-2-piperidin-3-ylsulfonylpyridine (PubChem CID 71635609) has the molecular formula C10H13N3O4S and a molecular weight of 271.30 g/mol. Its IUPAC name is 3-nitro-2-piperidin-3-ylsulfonylpyridine.
| Compound Name | 3-nitro-2-piperidin-3-ylsulfonylpyridine |
|---|---|
| PubChem CID | 71635609 |
| Molecular Formula | C10H13N3O4S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 3-nitro-2-piperidin-3-ylsulfonylpyridine |
| SMILES | O=[N+]([O-])c1cccnc1S(=O)(=O)C1CCCNC1 |
| InChI | InChI=1S/C10H13N3O4S/c14-13(15)9-4-2-6-12-10(9)18(16,17)8-3-1-5-11-7-8/h2,4,6,8,11H,1,3,5,7H2 |
| InChIKey | GTQXFZVNMGEDKF-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|